CAS 111477-98-6 appears in our catalog under these names: 7-Fluoro-2,2-dimethyl-3,4-dihydro-2h-1-benzopyran-4-one, 95%, 7–Fluoro–2,2–dimethylchroman–4–one, 7-Fluoro-2,3-dihydro-2,2-dimethylchromen-4-one, 7-Fluoro-2,2-dimethylchroman-4-one, 97%, 97%, 7-Fluoro-2,2-dimethylchroman-4-one, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 2,5g, 250mg, 5g.
7-fluoro-2,2-dimethyl-3H-chromen-4-one (CAS 111477-98-6) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 7-fluoro-2,2-dimethyl-3H-chromen-4-one. InChIKey: MWTQZPUQPCIGJM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 7-fluoro-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | MWTQZPUQPCIGJM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=C(C=C2)F)C |
Computed by PubChem (NCBI)