CAS 197706-50-6 appears in our catalog under these names: Nebivolol Impurity 7, Nebivolol Impurity 24, Nebivolol Impurity 19, (2R,2’R)-6-Fluoro-2-(2’-oxiranyl)chromane. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R)-6-fluoro-2-[(2R)-oxiran-2-yl]-3,4-dihydro-2H-chromene (CAS 197706-50-6) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: (2R)-6-fluoro-2-[(2R)-oxiran-2-yl]-3,4-dihydro-2H-chromene. InChIKey: GVZDIJGBXSDSEP-GHMZBOCLSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | (2R)-6-fluoro-2-[(2R)-oxiran-2-yl]-3,4-dihydro-2H-chromene |
| InChIKey | GVZDIJGBXSDSEP-GHMZBOCLSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@H]1[C@H]3CO3 |
Computed by PubChem (NCBI)