CAS 1416979-62-8 is the registry number for Ethyl 2-fluoro-4-vinylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 4-ethenyl-2-fluorobenzoate (CAS 1416979-62-8) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: ethyl 4-ethenyl-2-fluorobenzoate. InChIKey: BKCDROWAVHRWTK-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | ethyl 4-ethenyl-2-fluorobenzoate |
| InChIKey | BKCDROWAVHRWTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C=C)F |
Computed by PubChem (NCBI)