Products 129050-29-9
CAS 129050-29-9 appears in our catalog under these names: Nebivolol Impurity 28, Nebivolol Impurity 4. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(2S)-6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene (CAS 129050-29-9) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: (2S)-6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene. InChIKey: GVZDIJGBXSDSEP-VUWPPUDQSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | (2S)-6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene |
| InChIKey | GVZDIJGBXSDSEP-VUWPPUDQSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@@H]1C3CO3 |
Computed by PubChem (NCBI)