CAS 1246820-59-6 appears in our catalog under these names: *Ethylone-d5, Ethylone-d5. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
1-(1,3-benzodioxol-5-yl)-2-(1,1,2,2,2-pentadeuterioethylamino)propan-1-one (CAS 1246820-59-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 226.28 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(1,1,2,2,2-pentadeuterioethylamino)propan-1-one. InChIKey: MJEMIOXXNCZZFK-WNWXXORZSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(1,1,2,2,2-pentadeuterioethylamino)propan-1-one |
| InChIKey | MJEMIOXXNCZZFK-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC(C)C(=O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)