Products 1246911-78-3
CAS 1246911-78-3 appears in our catalog under these names: 1-Hydroxy Tacrine-d4, Hydroxy Tacrine-d4, Velnacrine-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg.
9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol (CAS 1246911-78-3) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 218.29 g/mol. IUPAC name: 9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol. InChIKey: HLVVITIHAZBPKB-GYABSUSNSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol |
| InChIKey | HLVVITIHAZBPKB-GYABSUSNSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(CCCC3=N2)O)N)[2H])[2H] |
Computed by PubChem (NCBI)