CAS 1247135-06-3 is the registry number for 1-(2-Azidoethyl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-azidoethyl)benzimidazole (CAS 1247135-06-3) is a chemical compound with the molecular formula C9H9N5 and a molecular weight of 187.20 g/mol. IUPAC name: 1-(2-azidoethyl)benzimidazole. InChIKey: OTHSIBYYPPIMQY-UHFFFAOYSA-N.
| Molecular formula | C9H9N5 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 1-(2-azidoethyl)benzimidazole |
| InChIKey | OTHSIBYYPPIMQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2CCN=[N+]=[N-] |
Computed by PubChem (NCBI)