CAS 91-76-9 appears in our catalog under these names: 6-Phenyl-1,3,5-triazine-2,4-diamine, >95% (HPLC), Benzoguanamine, 2,4–Diamino–6–phenyl–1,3,5–triazine, Benzoguanamine, 99% , Benzoguanamine, >99.0%(HPLC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 2,5g, 250mg, 500mg, 100mg, 500g, 2500g, 100g, 25g.
6-phenyl-1,3,5-triazine-2,4-diamine (CAS 91-76-9) is a chemical compound with the molecular formula C9H9N5 and a molecular weight of 187.20 g/mol. IUPAC name: 6-phenyl-1,3,5-triazine-2,4-diamine. InChIKey: GZVHEAJQGPRDLQ-UHFFFAOYSA-N.
| Molecular formula | C9H9N5 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 6-phenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | GZVHEAJQGPRDLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)