CAS 28735-29-7 is the registry number for 3-Hydrazino-5-phenyl-1,2,4-triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-phenyl-1,2,4-triazin-3-yl)hydrazine (CAS 28735-29-7) is a chemical compound with the molecular formula C9H9N5 and a molecular weight of 187.20 g/mol. IUPAC name: (5-phenyl-1,2,4-triazin-3-yl)hydrazine. InChIKey: XNMHGSWBLYFSHI-UHFFFAOYSA-N.
| Molecular formula | C9H9N5 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | (5-phenyl-1,2,4-triazin-3-yl)hydrazine |
| InChIKey | XNMHGSWBLYFSHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=NC(=N2)NN |
Computed by PubChem (NCBI)