CAS 657411-85-3 is the registry number for 4-Methyl-6-(pyridin-2-yl)-1,3,5-triazin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-amine (CAS 657411-85-3) is a chemical compound with the molecular formula C9H9N5 and a molecular weight of 187.20 g/mol. IUPAC name: 4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-amine. InChIKey: LMLDQWNLXCGEKR-UHFFFAOYSA-N.
| Molecular formula | C9H9N5 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-amine |
| InChIKey | LMLDQWNLXCGEKR-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)N)C2=CC=CC=N2 |
Computed by PubChem (NCBI)