CAS 124717-60-8 appears in our catalog under these names: 2-(3-Bromo-4-methylphenyl)-1,3-dioxolane, 95%, 2-(3-Bromo-4-methylphenyl)-1,3-dioxolane, 98%, 2-(3-Bromo-4-methylphenyl)-1,3-dioxolane, ≥95%, ≥95%, 2-(3-Bromo-4-methylphenyl)-1,3-dioxolane. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
2-(3-bromo-4-methylphenyl)-1,3-dioxolane (CAS 124717-60-8) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(3-bromo-4-methylphenyl)-1,3-dioxolane. InChIKey: YTQXPAWDHPRBBM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(3-bromo-4-methylphenyl)-1,3-dioxolane |
| InChIKey | YTQXPAWDHPRBBM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2OCCO2)Br |
Computed by PubChem (NCBI)