CAS 1247184-36-6 is the registry number for 1-(4-Chlorophenyl)-3,4-dimethyl-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-chlorophenyl)-4,5-dimethylpyrazol-3-amine (CAS 1247184-36-6) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-4,5-dimethylpyrazol-3-amine. InChIKey: MYQDVQRVMNQDBF-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4,5-dimethylpyrazol-3-amine |
| InChIKey | MYQDVQRVMNQDBF-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)