Products 124728-45-6
CAS 124728-45-6 appears in our catalog under these names: 4-Ethoxy-2,3-difluorobenzoic acid, 97%, 4–Ethoxy–2，3–difluorobenzoic acid, 2,3-Difluoro-4-ethoxybenzoic acid, 4-Ethoxy-2,3-difluorobenzoic acid, 98+%, 98+%, 2,3-Difluoro-4-ethoxybenzoic acid, min. 95 %, 1 g. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 250mg, 1g, 10g, 5g, 2g, 2.5g.
4-ethoxy-2,3-difluorobenzoic acid (CAS 124728-45-6) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 4-ethoxy-2,3-difluorobenzoic acid. InChIKey: KMFHBAZUQFJVKK-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 4-ethoxy-2,3-difluorobenzoic acid |
| InChIKey | KMFHBAZUQFJVKK-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)O)F)F |
Computed by PubChem (NCBI)
Synonyms:
4-ethoxy-2,3-difluorobenzoic acid, 2,3-Difluoro-4-ethoxybenzoic acid, Benzoic acid, 4-ethoxy-2,3-difluoro-, Benzoic acid, 4-ethoxy-2,3-difluoro- (9CI), 4-Carboxy-2,3-difluorophenetole, 4-ethoxy-2,3-difluoro-benzoic Acid, 4-Ethoxy-2,3-difluoro benzoic acid, 4-ethoxy-2,3-difluorobenzoicacid, 4-Ethoxy-23-difluorobenzoic acid, KMFHBAZUQFJVKK-UHFFFAOYSA-N