CAS 1247342-03-5 appears in our catalog under these names: 4-(Methoxymethyl)-1,3-benzothiazol-2-amine, 95%, 4-(Methoxymethyl)-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(methoxymethyl)-1,3-benzothiazol-2-amine (CAS 1247342-03-5) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 4-(methoxymethyl)-1,3-benzothiazol-2-amine. InChIKey: JKVJADAMNCFLFD-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-(methoxymethyl)-1,3-benzothiazol-2-amine |
| InChIKey | JKVJADAMNCFLFD-UHFFFAOYSA-N |
| SMILES | COCC1=C2C(=CC=C1)SC(=N2)N |
Computed by PubChem (NCBI)