Products 1247398-83-9
CAS 1247398-83-9 appears in our catalog under these names: 1-(5-Bromopyridin-2-yl)piperidine-4-carboxamide, 95%, 1-(5-Bromopyridin-2-yl)piperidine-4-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(5-bromo-2-pyridinyl)piperidine-4-carboxamide (CAS 1247398-83-9) is a chemical compound with the molecular formula C11H14BrN3O and a molecular weight of 284.15 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperidine-4-carboxamide. InChIKey: USKDPTOKHGSGHP-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperidine-4-carboxamide |
| InChIKey | USKDPTOKHGSGHP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)