Products 1344239-32-2
CAS 1344239-32-2 is the registry number for 4-(2-Amino-4-bromophenyl)-1-methylpiperazin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2-amino-4-bromophenyl)-1-methylpiperazin-2-one (CAS 1344239-32-2) is a chemical compound with the molecular formula C11H14BrN3O and a molecular weight of 284.15 g/mol. IUPAC name: 4-(2-amino-4-bromophenyl)-1-methylpiperazin-2-one. InChIKey: LNHSDCPLEAEBLN-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 4-(2-amino-4-bromophenyl)-1-methylpiperazin-2-one |
| InChIKey | LNHSDCPLEAEBLN-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1=O)C2=C(C=C(C=C2)Br)N |
Computed by PubChem (NCBI)