CAS 909712-01-2 is the registry number for (5-Bromopyridin-2-yl)(4-methylpiperazin-1-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(5-bromo-2-pyridinyl)-(4-methylpiperazin-1-yl)methanone (CAS 909712-01-2) is a chemical compound with the molecular formula C11H14BrN3O and a molecular weight of 284.15 g/mol. IUPAC name: (5-bromo-2-pyridinyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: RQZKEONFOSUEOE-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | (5-bromo-2-pyridinyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | RQZKEONFOSUEOE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)