Products 1250050-53-3
CAS 1250050-53-3 is the registry number for 1-(5-Bromopyridin-2-yl)piperidine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5-bromo-2-pyridinyl)piperidine-3-carboxamide (CAS 1250050-53-3) is a chemical compound with the molecular formula C11H14BrN3O and a molecular weight of 284.15 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperidine-3-carboxamide. InChIKey: XSJQEYPKQQIPAU-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperidine-3-carboxamide |
| InChIKey | XSJQEYPKQQIPAU-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC=C(C=C2)Br)C(=O)N |
Computed by PubChem (NCBI)