CAS 124753-65-7 appears in our catalog under these names: Z-1,2-Cis-achec-oh, 95%, cis-6-(((Benzyloxy)carbonyl)amino)cyclohex-3-enecarboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
(1R,6S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid (CAS 124753-65-7) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: (1R,6S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid. InChIKey: QIAAZWPFGHTXNZ-OLZOCXBDSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (1R,6S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid |
| InChIKey | QIAAZWPFGHTXNZ-OLZOCXBDSA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)