CAS 475291-59-9 is the registry number for Z-1,2-Trans-achec-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1S,6S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid (CAS 475291-59-9) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: (1S,6S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid. InChIKey: QIAAZWPFGHTXNZ-STQMWFEESA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (1S,6S)-6-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid |
| InChIKey | QIAAZWPFGHTXNZ-STQMWFEESA-N |
| SMILES | C1C=CC[C@@H]([C@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)