CAS 132785-19-4 is the registry number for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (CAS 132785-19-4) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate. InChIKey: FCVRGPUDVVLQRT-LBPRGKRZSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| InChIKey | FCVRGPUDVVLQRT-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)