CAS 272438-11-6 appears in our catalog under these names: Methyl 1-BOC-indole-5-carboxylate, 95%, 1-tert-Butyl 5-methyl 1H-indole-1,5-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
1-O-tert-butyl 5-O-methyl indole-1,5-dicarboxylate (CAS 272438-11-6) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl indole-1,5-dicarboxylate. InChIKey: AYLPJERLLUZRGD-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl indole-1,5-dicarboxylate |
| InChIKey | AYLPJERLLUZRGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)