CAS 1247575-27-4 appears in our catalog under these names: 1-(2,5-Dimethylphenyl)-5-methyl-1H-pyrazol-4-amine, 95%, 1-(2,5-Dimethylphenyl)-5-methyl-1H-pyrazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,5-dimethylphenyl)-5-methylpyrazol-4-amine (CAS 1247575-27-4) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: 1-(2,5-dimethylphenyl)-5-methylpyrazol-4-amine. InChIKey: QIOOXYFXEDLTSJ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | 1-(2,5-dimethylphenyl)-5-methylpyrazol-4-amine |
| InChIKey | QIOOXYFXEDLTSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=C(C=N2)N)C |
Computed by PubChem (NCBI)