CAS 1247717-53-8 is the registry number for 1-Iodo-2-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-iodo-2-(2,2,2-trifluoroethoxy)benzene (CAS 1247717-53-8) is a chemical compound with the molecular formula C8H6F3IO and a molecular weight of 302.03 g/mol. IUPAC name: 1-iodo-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: KRXSODMETLOUAT-UHFFFAOYSA-N.
| Molecular formula | C8H6F3IO |
|---|---|
| Molecular weight | 302.03 g/mol |
| IUPAC name | 1-iodo-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | KRXSODMETLOUAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(F)(F)F)I |
Computed by PubChem (NCBI)