Products 868167-60-6
CAS 868167-60-6 appears in our catalog under these names: 1-Iodo-3-methoxy-5-(trifluoromethyl)benzene, 98%, 1-IODO-3-METHOXY-5-(TRIFLUOROMETHYL)BENZENE. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g.
1-iodo-3-methoxy-5-(trifluoromethyl)benzene (CAS 868167-60-6) is a chemical compound with the molecular formula C8H6F3IO and a molecular weight of 302.03 g/mol. IUPAC name: 1-iodo-3-methoxy-5-(trifluoromethyl)benzene. InChIKey: CXZYUVZKTYSSFL-UHFFFAOYSA-N.
| Molecular formula | C8H6F3IO |
|---|---|
| Molecular weight | 302.03 g/mol |
| IUPAC name | 1-iodo-3-methoxy-5-(trifluoromethyl)benzene |
| InChIKey | CXZYUVZKTYSSFL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(F)(F)F)I |
Computed by PubChem (NCBI)