Products 372120-52-0
CAS 372120-52-0 is the registry number for 3-Iodo-4-(trifluoromethyl)benzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 5g.
[3-iodo-4-(trifluoromethyl)phenyl]methanol (CAS 372120-52-0) is a chemical compound with the molecular formula C8H6F3IO and a molecular weight of 302.03 g/mol. IUPAC name: [3-iodo-4-(trifluoromethyl)phenyl]methanol. InChIKey: BWKLQWPKQYHQHM-UHFFFAOYSA-N.
| Molecular formula | C8H6F3IO |
|---|---|
| Molecular weight | 302.03 g/mol |
| IUPAC name | [3-iodo-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | BWKLQWPKQYHQHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)I)C(F)(F)F |
Computed by PubChem (NCBI)