CAS 868167-58-2 appears in our catalog under these names: 3-Iodo-5-(trifluoromethyl)benzyl alcohol, 95%, (3-Iodo-5-(trifluoromethyl)phenyl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[3-iodo-5-(trifluoromethyl)phenyl]methanol (CAS 868167-58-2) is a chemical compound with the molecular formula C8H6F3IO and a molecular weight of 302.03 g/mol. IUPAC name: [3-iodo-5-(trifluoromethyl)phenyl]methanol. InChIKey: SDEIKGNIPZOYBL-UHFFFAOYSA-N.
| Molecular formula | C8H6F3IO |
|---|---|
| Molecular weight | 302.03 g/mol |
| IUPAC name | [3-iodo-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | SDEIKGNIPZOYBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)I)CO |
Computed by PubChem (NCBI)