Products 1247732-24-6
CAS 1247732-24-6 is the registry number for 5-(Oxolan-2-yl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(oxolan-2-yl)-1,3-oxazole-4-carboxylic acid (CAS 1247732-24-6) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 5-(oxolan-2-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: ZLZBXGNDIVSVBY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 5-(oxolan-2-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZLZBXGNDIVSVBY-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)