CAS 1247756-17-7 is the registry number for 1,2,3,4-Tetrahydronaphthalene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,2,3,4-tetrahydronaphthalene-1-sulfonamide (CAS 1247756-17-7) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 1,2,3,4-tetrahydronaphthalene-1-sulfonamide. InChIKey: SRYALXBZLHTHHG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 1,2,3,4-tetrahydronaphthalene-1-sulfonamide |
| InChIKey | SRYALXBZLHTHHG-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)S(=O)(=O)N |
Computed by PubChem (NCBI)