Products 1247788-39-1
CAS 1247788-39-1 is the registry number for tert-Butyl 2-(3-amino-1H-1,2,4-triazol-1-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (CAS 1247788-39-1) is a chemical compound with the molecular formula C8H14N4O2 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 2-(3-amino-1,2,4-triazol-1-yl)acetate. InChIKey: JRPAVIYBSOELDJ-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| InChIKey | JRPAVIYBSOELDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C=NC(=N1)N |
Computed by PubChem (NCBI)