Products 1247942-74-0

CAS 1247942-74-0 appears in our catalog under these names: 2,2-Difluoro-2-(5-fluoro-2-methylphenyl)acetic acid, 95%, 2,2-Difluoro-2-(5-fluoro-2-methylphenyl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,2-difluoro-2-(5-fluoro-2-methylphenyl)acetic acid (CAS 1247942-74-0) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2,2-difluoro-2-(5-fluoro-2-methylphenyl)acetic acid. InChIKey: VYOZMLBGGPNICM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O2
Molecular weight204.15 g/mol
IUPAC name2,2-difluoro-2-(5-fluoro-2-methylphenyl)acetic acid
InChIKeyVYOZMLBGGPNICM-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)F)C(C(=O)O)(F)F

Computed by PubChem (NCBI)