Products 1248060-82-3
CAS 1248060-82-3 is the registry number for 1-(4-(Aminomethyl)phenyl)-1,3-diazinan-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[4-(aminomethyl)phenyl]-1,3-diazinan-2-one (CAS 1248060-82-3) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: 1-[4-(aminomethyl)phenyl]-1,3-diazinan-2-one. InChIKey: VWXQJZPXBUAUMY-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | 1-[4-(aminomethyl)phenyl]-1,3-diazinan-2-one |
| InChIKey | VWXQJZPXBUAUMY-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)