Products 1248347-12-7
CAS 1248347-12-7 is the registry number for 6-Chloro-7-methoxy-2-methyl-4(1H)-quinolinone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-chloro-7-methoxy-2-methyl-1H-quinolin-4-one (CAS 1248347-12-7) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 6-chloro-7-methoxy-2-methyl-1H-quinolin-4-one. InChIKey: YBAFNTKBWYZCNR-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 6-chloro-7-methoxy-2-methyl-1H-quinolin-4-one |
| InChIKey | YBAFNTKBWYZCNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=CC(=C(C=C2N1)OC)Cl |
Computed by PubChem (NCBI)