CAS 124842-29-1 appears in our catalog under these names: Tert-butyl (S)-(2,5-dioxopyrrolidin-3-yl)carbamate, 98%, 98%, (S)-3-(BOC-AMINO)PYRROLIDINE-2,5-DIONE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(3S)-2,5-dioxopyrrolidin-3-yl]carbamate (CAS 124842-29-1) is a chemical compound with the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. IUPAC name: tert-butyl N-[(3S)-2,5-dioxopyrrolidin-3-yl]carbamate. InChIKey: ADNLCKRUARJETQ-YFKPBYRVSA-N.
| Molecular formula | C9H14N2O4 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | tert-butyl N-[(3S)-2,5-dioxopyrrolidin-3-yl]carbamate |
| InChIKey | ADNLCKRUARJETQ-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(=O)NC1=O |
Computed by PubChem (NCBI)