Products 1609396-45-3

CAS 1609396-45-3 is the registry number for 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrate (CAS 1609396-45-3) is a chemical compound with the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. IUPAC name: 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrate. InChIKey: JOMFKCGCLKCZMA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14N2O4
Molecular weight214.22 g/mol
IUPAC name6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrate
InChIKeyJOMFKCGCLKCZMA-UHFFFAOYSA-N
SMILESCC(C)CC1=CC(=NC(=O)N1)C(=O)O.O

Computed by PubChem (NCBI)