CAS 187226-83-1 appears in our catalog under these names: Oseltamivir Impurity 57, Oseltamivir Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexene-1-carboxylic acid (CAS 187226-83-1) is a chemical compound with the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. IUPAC name: (3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexene-1-carboxylic acid. InChIKey: TTYVWILEGNYIQI-XLPZGREQSA-N.
| Molecular formula | C9H14N2O4 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | (3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexene-1-carboxylic acid |
| InChIKey | TTYVWILEGNYIQI-XLPZGREQSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](CC(=C[C@H]1O)C(=O)O)N |
Computed by PubChem (NCBI)