CAS 852934-04-4 appears in our catalog under these names: 4-(4,4-Dimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid, 95%, 4-(4,4-Dimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid (CAS 852934-04-4) is a chemical compound with the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. IUPAC name: 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid. InChIKey: JDLQGFILKCTFKI-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O4 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid |
| InChIKey | JDLQGFILKCTFKI-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CCCC(=O)O)C |
Computed by PubChem (NCBI)