CAS 124847-00-3 appears in our catalog under these names: Epinastine Impurity 13, Epinastine Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(Z)-C-phenylcarbonohydrazonoyl]aniline (CAS 124847-00-3) is a chemical compound with the molecular formula C13H13N3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-[(Z)-C-phenylcarbonohydrazonoyl]aniline. InChIKey: LLPGEPRZHOMDHC-SSZFMOIBSA-N.
| Molecular formula | C13H13N3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-[(Z)-C-phenylcarbonohydrazonoyl]aniline |
| InChIKey | LLPGEPRZHOMDHC-SSZFMOIBSA-N |
| SMILES | C1=CC=C(C=C1)/C(=N/N)/C2=CC=CC=C2N |
Computed by PubChem (NCBI)