CAS 1403483-66-8 is the registry number for 1-Cyclopentyl-1,3-benzodiazole-5-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-cyclopentylbenzimidazole-5-carbonitrile (CAS 1403483-66-8) is a chemical compound with the molecular formula C13H13N3 and a molecular weight of 211.26 g/mol. IUPAC name: 1-cyclopentylbenzimidazole-5-carbonitrile. InChIKey: YWSJMFKJCNVQTC-UHFFFAOYSA-N.
| Molecular formula | C13H13N3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 1-cyclopentylbenzimidazole-5-carbonitrile |
| InChIKey | YWSJMFKJCNVQTC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=NC3=C2C=CC(=C3)C#N |
Computed by PubChem (NCBI)