CAS 20277-92-3 is the registry number for N,N-Diphenylguanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1,1-diphenylguanidine (CAS 20277-92-3) is a chemical compound with the molecular formula C13H13N3 and a molecular weight of 211.26 g/mol. IUPAC name: 1,1-diphenylguanidine. InChIKey: MFHNAXHSHOCFEC-UHFFFAOYSA-N.
| Molecular formula | C13H13N3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 1,1-diphenylguanidine |
| InChIKey | MFHNAXHSHOCFEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=N)N |
Computed by PubChem (NCBI)