CAS 553-74-2 is the registry number for 2-Aminobenzaldehyde phenylhydrazone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(E)-(phenylhydrazinylidene)methyl]aniline (CAS 553-74-2) is a chemical compound with the molecular formula C13H13N3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-[(E)-(phenylhydrazinylidene)methyl]aniline. InChIKey: LCPNCBSCOIMOBC-XNTDXEJSSA-N.
| Molecular formula | C13H13N3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-[(E)-(phenylhydrazinylidene)methyl]aniline |
| InChIKey | LCPNCBSCOIMOBC-XNTDXEJSSA-N |
| SMILES | C1=CC=C(C=C1)N/N=C/C2=CC=CC=C2N |
Computed by PubChem (NCBI)