CAS 1248541-61-8 is the registry number for Methyl 2,3-diamino-5-fluorobenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2,3-diamino-5-fluorobenzoate (CAS 1248541-61-8) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: methyl 2,3-diamino-5-fluorobenzoate. InChIKey: ADEDGAKMZOCLDK-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | methyl 2,3-diamino-5-fluorobenzoate |
| InChIKey | ADEDGAKMZOCLDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)N)N |
Computed by PubChem (NCBI)