CAS 1248551-74-7 appears in our catalog under these names: 1,3,3,7-Tetramethyl-5-nitro-1,3-dihydro-2h-indol-2-one, 95%, 1,3,3,7-Tetramethyl-5-nitroindolin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,3,3,7-tetramethyl-5-nitroindol-2-one (CAS 1248551-74-7) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 1,3,3,7-tetramethyl-5-nitroindol-2-one. InChIKey: CKYUFXYKKWJKCC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1,3,3,7-tetramethyl-5-nitroindol-2-one |
| InChIKey | CKYUFXYKKWJKCC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N(C(=O)C2(C)C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)