Products 1248649-02-6

CAS 1248649-02-6 is the registry number for Methyl 2-((6-fluoropyridin-2-yl)amino)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[(6-fluoro-2-pyridinyl)amino]acetate (CAS 1248649-02-6) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: methyl 2-[(6-fluoro-2-pyridinyl)amino]acetate. InChIKey: JSZRDNBBEMPWGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9FN2O2
Molecular weight184.17 g/mol
IUPAC namemethyl 2-[(6-fluoro-2-pyridinyl)amino]acetate
InChIKeyJSZRDNBBEMPWGQ-UHFFFAOYSA-N
SMILESCOC(=O)CNC1=NC(=CC=C1)F

Computed by PubChem (NCBI)