Products 1248946-64-6

CAS 1248946-64-6 is the registry number for 1-((Oxolan-3-yl)methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(oxolan-3-ylmethyl)triazole-4-carboxylic acid (CAS 1248946-64-6) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: 1-(oxolan-3-ylmethyl)triazole-4-carboxylic acid. InChIKey: XYHRNKMEKLECCT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11N3O3
Molecular weight197.19 g/mol
IUPAC name1-(oxolan-3-ylmethyl)triazole-4-carboxylic acid
InChIKeyXYHRNKMEKLECCT-UHFFFAOYSA-N
SMILESC1COCC1CN2C=C(N=N2)C(=O)O

Computed by PubChem (NCBI)