Products 1248997-57-0
CAS 1248997-57-0 is the registry number for 2-(Dimethylamino)-2-(5-methylthiophen-2-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(dimethylamino)-2-(5-methylthiophen-2-yl)acetic acid (CAS 1248997-57-0) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2-(dimethylamino)-2-(5-methylthiophen-2-yl)acetic acid. InChIKey: WKUUPRGUKNLLFC-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2-(dimethylamino)-2-(5-methylthiophen-2-yl)acetic acid |
| InChIKey | WKUUPRGUKNLLFC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C(C(=O)O)N(C)C |
Computed by PubChem (NCBI)