Products 124915-24-8
CAS 124915-24-8 is the registry number for (+)-Carbovir. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-9-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one (CAS 124915-24-8) is a chemical compound with the molecular formula C11H13N5O2 and a molecular weight of 247.25 g/mol. IUPAC name: 2-amino-9-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one. InChIKey: XSSYCIGJYCVRRK-NKWVEPMBSA-N.
| Molecular formula | C11H13N5O2 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-amino-9-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one |
| InChIKey | XSSYCIGJYCVRRK-NKWVEPMBSA-N |
| SMILES | C1[C@H](C=C[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO |
Computed by PubChem (NCBI)