CAS 1249199-30-1 is the registry number for Ethyl 5'-fluoro-2'-methylbenzoylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 3-(5-fluoro-2-methylphenyl)-3-oxopropanoate (CAS 1249199-30-1) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: ethyl 3-(5-fluoro-2-methylphenyl)-3-oxopropanoate. InChIKey: VGJUIZLAABNBIR-UHFFFAOYSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | ethyl 3-(5-fluoro-2-methylphenyl)-3-oxopropanoate |
| InChIKey | VGJUIZLAABNBIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=C(C=CC(=C1)F)C |
Computed by PubChem (NCBI)