CAS 2408837-89-6 is the registry number for ((1S,2S)-1-Fluoro-2-(hydroxymethyl)cyclopropyl)methyl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl benzoate (CAS 2408837-89-6) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: [(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl benzoate. InChIKey: ZZDXSBNNCGWDFZ-CMPLNLGQSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | [(1S,2S)-1-fluoro-2-(hydroxymethyl)cyclopropyl]methyl benzoate |
| InChIKey | ZZDXSBNNCGWDFZ-CMPLNLGQSA-N |
| SMILES | C1[C@H]([C@@]1(COC(=O)C2=CC=CC=C2)F)CO |
Computed by PubChem (NCBI)