CAS 2055840-75-8 appears in our catalog under these names: (1S,2S)-Rel-2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid, 95%, (1S,2S)-Rel-2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid, 97%, (1S,2S)-Rel-2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
Trans-(1S,2S)-2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 2055840-75-8) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: trans-(1S,2S)-2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: OKKIOWQOTCYRRS-BDAKNGLRSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | OKKIOWQOTCYRRS-BDAKNGLRSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[C@H]2C[C@@H]2C(=O)O)F |
Computed by PubChem (NCBI)